C21H22N4O5S — CID 46547039
N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-2-(4-pyrrol-1-ylphenyl)acetamide (PubChem CID 46547039) has the molecular formula C21H22N4O5S and a molecular weight of 442.50 g/mol. Its IUPAC name is N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-2-(4-pyrrol-1-ylphenyl)acetamide.
| Compound Name | N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-2-(4-pyrrol-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 46547039 |
| Molecular Formula | C21H22N4O5S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-2-(4-pyrrol-1-ylphenyl)acetamide |
| SMILES | CS(=O)(=O)c1ccc(NCCNC(=O)Cc2ccc(-n3cccc3)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H22N4O5S/c1-31(29,30)18-8-9-19(20(15-18)25(27)28)22-10-11-23-21(26)14-16-4-6-17(7-5-16)24-12-2-3-13-24/h2-9,12-13,15,22H,10-11,14H2,1H3,(H,23,26) |
| InChIKey | BJYXCNHIBUQTCK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 123.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|