C20H21N5O5S — CID 24504847
1-benzyl-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]pyrazole-4-carboxamide (PubChem CID 24504847) has the molecular formula C20H21N5O5S and a molecular weight of 443.49 g/mol. Its IUPAC name is 1-benzyl-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]pyrazole-4-carboxamide.
| Compound Name | 1-benzyl-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 24504847 |
| Molecular Formula | C20H21N5O5S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 1-benzyl-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]pyrazole-4-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(NCCNC(=O)c2cnn(Cc3ccccc3)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H21N5O5S/c1-31(29,30)17-7-8-18(19(11-17)25(27)28)21-9-10-22-20(26)16-12-23-24(14-16)13-15-5-3-2-4-6-15/h2-8,11-12,14,21H,9-10,13H2,1H3,(H,22,26) |
| InChIKey | BGTHKTAGWKPLMU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 136.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|