C22H22FN3O6S — CID 24517079
3-[5-(2-fluorophenyl)furan-2-yl]-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]propanamide (PubChem CID 24517079) has the molecular formula C22H22FN3O6S and a molecular weight of 475.50 g/mol. Its IUPAC name is 3-[5-(2-fluorophenyl)furan-2-yl]-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]propanamide.
| Compound Name | 3-[5-(2-fluorophenyl)furan-2-yl]-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]propanamide |
|---|---|
| PubChem CID | 24517079 |
| Molecular Formula | C22H22FN3O6S |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 3-[5-(2-fluorophenyl)furan-2-yl]-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]propanamide |
| SMILES | CS(=O)(=O)c1ccc(NCCNC(=O)CCc2ccc(-c3ccccc3F)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H22FN3O6S/c1-33(30,31)16-8-9-19(20(14-16)26(28)29)24-12-13-25-22(27)11-7-15-6-10-21(32-15)17-4-2-3-5-18(17)23/h2-6,8-10,14,24H,7,11-13H2,1H3,(H,25,27) |
| InChIKey | NMXDVMWUCZGMEB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|