C18H22FNO2 — CID 46554729
3-[5-(2-fluorophenyl)furan-2-yl]-N-(2-methylbutan-2-yl)propanamide (PubChem CID 46554729) has the molecular formula C18H22FNO2 and a molecular weight of 303.38 g/mol. Its IUPAC name is 3-[5-(2-fluorophenyl)furan-2-yl]-N-(2-methylbutan-2-yl)propanamide.
| Compound Name | 3-[5-(2-fluorophenyl)furan-2-yl]-N-(2-methylbutan-2-yl)propanamide |
|---|---|
| PubChem CID | 46554729 |
| Molecular Formula | C18H22FNO2 |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 3-[5-(2-fluorophenyl)furan-2-yl]-N-(2-methylbutan-2-yl)propanamide |
| SMILES | CCC(C)(C)NC(=O)CCc1ccc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C18H22FNO2/c1-4-18(2,3)20-17(21)12-10-13-9-11-16(22-13)14-7-5-6-8-15(14)19/h5-9,11H,4,10,12H2,1-3H3,(H,20,21) |
| InChIKey | UPZHLXGZHVOAGZ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |