C17H19FN2O3 — CID 30598254
N-(2-acetamidoethyl)-3-[5-(2-fluorophenyl)furan-2-yl]propanamide (PubChem CID 30598254) has the molecular formula C17H19FN2O3 and a molecular weight of 318.35 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-3-[5-(2-fluorophenyl)furan-2-yl]propanamide.
| Compound Name | N-(2-acetamidoethyl)-3-[5-(2-fluorophenyl)furan-2-yl]propanamide |
|---|---|
| PubChem CID | 30598254 |
| Molecular Formula | C17H19FN2O3 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-(2-acetamidoethyl)-3-[5-(2-fluorophenyl)furan-2-yl]propanamide |
| SMILES | CC(=O)NCCNC(=O)CCc1ccc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C17H19FN2O3/c1-12(21)19-10-11-20-17(22)9-7-13-6-8-16(23-13)14-4-2-3-5-15(14)18/h2-6,8H,7,9-11H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | KSKHXCCAUIOZDM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|