C21H19F2NO2 — CID 16580078
N-[(4-fluoro-3-methylphenyl)methyl]-3-[5-(2-fluorophenyl)furan-2-yl]propanamide (PubChem CID 16580078) has the molecular formula C21H19F2NO2 and a molecular weight of 355.38 g/mol. Its IUPAC name is N-[(4-fluoro-3-methylphenyl)methyl]-3-[5-(2-fluorophenyl)furan-2-yl]propanamide.
| Compound Name | N-[(4-fluoro-3-methylphenyl)methyl]-3-[5-(2-fluorophenyl)furan-2-yl]propanamide |
|---|---|
| PubChem CID | 16580078 |
| Molecular Formula | C21H19F2NO2 |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N-[(4-fluoro-3-methylphenyl)methyl]-3-[5-(2-fluorophenyl)furan-2-yl]propanamide |
| SMILES | Cc1cc(CNC(=O)CCc2ccc(-c3ccccc3F)o2)ccc1F |
| InChI | InChI=1S/C21H19F2NO2/c1-14-12-15(6-9-18(14)22)13-24-21(25)11-8-16-7-10-20(26-16)17-4-2-3-5-19(17)23/h2-7,9-10,12H,8,11,13H2,1H3,(H,24,25) |
| InChIKey | UGIRTKJZEJQTPK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |