C22H20F3NO3 — CID 134041285
N-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-[5-(2-fluorophenyl)furan-2-yl]propanamide (PubChem CID 134041285) has the molecular formula C22H20F3NO3 and a molecular weight of 403.40 g/mol. Its IUPAC name is N-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-[5-(2-fluorophenyl)furan-2-yl]propanamide.
| Compound Name | N-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-[5-(2-fluorophenyl)furan-2-yl]propanamide |
|---|---|
| PubChem CID | 134041285 |
| Molecular Formula | C22H20F3NO3 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | N-[2-[4-(difluoromethoxy)phenyl]ethyl]-3-[5-(2-fluorophenyl)furan-2-yl]propanamide |
| SMILES | O=C(CCc1ccc(-c2ccccc2F)o1)NCCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C22H20F3NO3/c23-19-4-2-1-3-18(19)20-11-9-16(28-20)10-12-21(27)26-14-13-15-5-7-17(8-6-15)29-22(24)25/h1-9,11,22H,10,12-14H2,(H,26,27) |
| InChIKey | IWYGEHLJFKFKDJ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |