C20H22FNO4 — CID 119229769
4-[3-[5-(2-fluorophenyl)furan-2-yl]propanoylamino]cyclohexane-1-carboxylic acid (PubChem CID 119229769) has the molecular formula C20H22FNO4 and a molecular weight of 359.40 g/mol. Its IUPAC name is 4-[3-[5-(2-fluorophenyl)furan-2-yl]propanoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[3-[5-(2-fluorophenyl)furan-2-yl]propanoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 119229769 |
| Molecular Formula | C20H22FNO4 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 4-[3-[5-(2-fluorophenyl)furan-2-yl]propanoylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(CCc1ccc(-c2ccccc2F)o1)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C20H22FNO4/c21-17-4-2-1-3-16(17)18-11-9-15(26-18)10-12-19(23)22-14-7-5-13(6-8-14)20(24)25/h1-4,9,11,13-14H,5-8,10,12H2,(H,22,23)(H,24,25) |
| InChIKey | VPFMWTCNMZNHNE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |