C21H23N5O6S — CID 37020807
3-(2-methyl-4-oxoquinazolin-3-yl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]propanamide (PubChem CID 37020807) has the molecular formula C21H23N5O6S and a molecular weight of 473.51 g/mol. Its IUPAC name is 3-(2-methyl-4-oxoquinazolin-3-yl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]propanamide.
| Compound Name | 3-(2-methyl-4-oxoquinazolin-3-yl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]propanamide |
|---|---|
| PubChem CID | 37020807 |
| Molecular Formula | C21H23N5O6S |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 3-(2-methyl-4-oxoquinazolin-3-yl)-N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]propanamide |
| SMILES | Cc1nc2ccccc2c(=O)n1CCC(=O)NCCNc1ccc(S(C)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H23N5O6S/c1-14-24-17-6-4-3-5-16(17)21(28)25(14)12-9-20(27)23-11-10-22-18-8-7-15(33(2,31)32)13-19(18)26(29)30/h3-8,13,22H,9-12H2,1-2H3,(H,23,27) |
| InChIKey | XHSMDAQGHCARJG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 153.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|