C21H21N3O5S2 — CID 27336137
N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-2-naphthalen-2-ylsulfanylacetamide (PubChem CID 27336137) has the molecular formula C21H21N3O5S2 and a molecular weight of 459.55 g/mol. Its IUPAC name is N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-2-naphthalen-2-ylsulfanylacetamide.
| Compound Name | N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-2-naphthalen-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 27336137 |
| Molecular Formula | C21H21N3O5S2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | N-[2-(4-methylsulfonyl-2-nitroanilino)ethyl]-2-naphthalen-2-ylsulfanylacetamide |
| SMILES | CS(=O)(=O)c1ccc(NCCNC(=O)CSc2ccc3ccccc3c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H21N3O5S2/c1-31(28,29)18-8-9-19(20(13-18)24(26)27)22-10-11-23-21(25)14-30-17-7-6-15-4-2-3-5-16(15)12-17/h2-9,12-13,22H,10-11,14H2,1H3,(H,23,25) |
| InChIKey | MXSMFYDKNFBVAZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|