C15H17F3N4O4 — CID 9277149
N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]-2-(2-oxopyrrolidin-1-yl)acetamide (PubChem CID 9277149) has the molecular formula C15H17F3N4O4 and a molecular weight of 374.32 g/mol. Its IUPAC name is N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]-2-(2-oxopyrrolidin-1-yl)acetamide.
| Compound Name | N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]-2-(2-oxopyrrolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 9277149 |
| Molecular Formula | C15H17F3N4O4 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]-2-(2-oxopyrrolidin-1-yl)acetamide |
| SMILES | O=C(CN1CCCC1=O)NCCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17F3N4O4/c16-15(17,18)10-3-4-11(12(8-10)22(25)26)19-5-6-20-13(23)9-21-7-1-2-14(21)24/h3-4,8,19H,1-2,5-7,9H2,(H,20,23) |
| InChIKey | IXQNGNSXCGVJIZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|