C14H17F3N4O3 — CID 119401775
3-[2-nitro-4-(trifluoromethyl)anilino]-1-piperazin-1-ylpropan-1-one (PubChem CID 119401775) has the molecular formula C14H17F3N4O3 and a molecular weight of 346.31 g/mol. Its IUPAC name is 3-[2-nitro-4-(trifluoromethyl)anilino]-1-piperazin-1-ylpropan-1-one.
| Compound Name | 3-[2-nitro-4-(trifluoromethyl)anilino]-1-piperazin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 119401775 |
| Molecular Formula | C14H17F3N4O3 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 3-[2-nitro-4-(trifluoromethyl)anilino]-1-piperazin-1-ylpropan-1-one |
| SMILES | O=C(CCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])N1CCNCC1 |
| InChI | InChI=1S/C14H17F3N4O3/c15-14(16,17)10-1-2-11(12(9-10)21(23)24)19-4-3-13(22)20-7-5-18-6-8-20/h1-2,9,18-19H,3-8H2 |
| InChIKey | WXZVBHSFDBKMRT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|