C17H23F3N4O3 — CID 120816029
1-(4-amino-3,3-dimethylpiperidin-1-yl)-3-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one (PubChem CID 120816029) has the molecular formula C17H23F3N4O3 and a molecular weight of 388.39 g/mol. Its IUPAC name is 1-(4-amino-3,3-dimethylpiperidin-1-yl)-3-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one.
| Compound Name | 1-(4-amino-3,3-dimethylpiperidin-1-yl)-3-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one |
|---|---|
| PubChem CID | 120816029 |
| Molecular Formula | C17H23F3N4O3 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 1-(4-amino-3,3-dimethylpiperidin-1-yl)-3-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one |
| SMILES | CC1(C)CN(C(=O)CCNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])CCC1N |
| InChI | InChI=1S/C17H23F3N4O3/c1-16(2)10-23(8-6-14(16)21)15(25)5-7-22-12-4-3-11(17(18,19)20)9-13(12)24(26)27/h3-4,9,14,22H,5-8,10,21H2,1-2H3 |
| InChIKey | SANKQWDJSMOCSV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|