C17H23F3N4O3 — CID 119396680
1-[3-(methylaminomethyl)piperidin-1-yl]-3-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one (PubChem CID 119396680) has the molecular formula C17H23F3N4O3 and a molecular weight of 388.39 g/mol. Its IUPAC name is 1-[3-(methylaminomethyl)piperidin-1-yl]-3-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one.
| Compound Name | 1-[3-(methylaminomethyl)piperidin-1-yl]-3-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one |
|---|---|
| PubChem CID | 119396680 |
| Molecular Formula | C17H23F3N4O3 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 1-[3-(methylaminomethyl)piperidin-1-yl]-3-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one |
| SMILES | CNCC1CCCN(C(=O)CCNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C17H23F3N4O3/c1-21-10-12-3-2-8-23(11-12)16(25)6-7-22-14-5-4-13(17(18,19)20)9-15(14)24(26)27/h4-5,9,12,21-22H,2-3,6-8,10-11H2,1H3 |
| InChIKey | QLDYDSQFIJVBMZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|