C21H28F3N5O4 — CID 55837953
1-[4-(4-methylpiperazine-1-carbonyl)piperidin-1-yl]-3-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one (PubChem CID 55837953) has the molecular formula C21H28F3N5O4 and a molecular weight of 471.48 g/mol. Its IUPAC name is 1-[4-(4-methylpiperazine-1-carbonyl)piperidin-1-yl]-3-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one.
| Compound Name | 1-[4-(4-methylpiperazine-1-carbonyl)piperidin-1-yl]-3-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one |
|---|---|
| PubChem CID | 55837953 |
| Molecular Formula | C21H28F3N5O4 |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | 1-[4-(4-methylpiperazine-1-carbonyl)piperidin-1-yl]-3-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one |
| SMILES | CN1CCN(C(=O)C2CCN(C(=O)CCNc3ccc(C(F)(F)F)cc3[N+](=O)[O-])CC2)CC1 |
| InChI | InChI=1S/C21H28F3N5O4/c1-26-10-12-28(13-11-26)20(31)15-5-8-27(9-6-15)19(30)4-7-25-17-3-2-16(21(22,23)24)14-18(17)29(32)33/h2-3,14-15,25H,4-13H2,1H3 |
| InChIKey | YDZQWJPLFZVYEL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|