C20H26F3N5O5 — CID 41257436
4-(morpholine-4-carbonyl)-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]piperidine-1-carboxamide (PubChem CID 41257436) has the molecular formula C20H26F3N5O5 and a molecular weight of 473.45 g/mol. Its IUPAC name is 4-(morpholine-4-carbonyl)-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]piperidine-1-carboxamide.
| Compound Name | 4-(morpholine-4-carbonyl)-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 41257436 |
| Molecular Formula | C20H26F3N5O5 |
| Molecular Weight | 473.45 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 4-(morpholine-4-carbonyl)-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]piperidine-1-carboxamide |
| SMILES | O=C(NCCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])N1CCC(C(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C20H26F3N5O5/c21-20(22,23)15-1-2-16(17(13-15)28(31)32)24-5-6-25-19(30)27-7-3-14(4-8-27)18(29)26-9-11-33-12-10-26/h1-2,13-14,24H,3-12H2,(H,25,30) |
| InChIKey | SEOXZWIDICVHPE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 117.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|