C19H23F3N4O4 — CID 56512140
1-[4-(cyclobutanecarbonyl)piperazin-1-yl]-3-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one (PubChem CID 56512140) has the molecular formula C19H23F3N4O4 and a molecular weight of 428.41 g/mol. Its IUPAC name is 1-[4-(cyclobutanecarbonyl)piperazin-1-yl]-3-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one.
| Compound Name | 1-[4-(cyclobutanecarbonyl)piperazin-1-yl]-3-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one |
|---|---|
| PubChem CID | 56512140 |
| Molecular Formula | C19H23F3N4O4 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 1-[4-(cyclobutanecarbonyl)piperazin-1-yl]-3-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one |
| SMILES | O=C(CCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])N1CCN(C(=O)C2CCC2)CC1 |
| InChI | InChI=1S/C19H23F3N4O4/c20-19(21,22)14-4-5-15(16(12-14)26(29)30)23-7-6-17(27)24-8-10-25(11-9-24)18(28)13-2-1-3-13/h4-5,12-13,23H,1-3,6-11H2 |
| InChIKey | HKMMRSFJTLKZCD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|