C17H24ClF3N4O3 — CID 119544614
1-[4-(methylaminomethyl)piperidin-1-yl]-3-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one;hydrochloride (PubChem CID 119544614) has the molecular formula C17H24ClF3N4O3 and a molecular weight of 424.85 g/mol. Its IUPAC name is 1-[4-(methylaminomethyl)piperidin-1-yl]-3-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one;hydrochloride.
| Compound Name | 1-[4-(methylaminomethyl)piperidin-1-yl]-3-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119544614 |
| Molecular Formula | C17H24ClF3N4O3 |
| Molecular Weight | 424.85 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 1-[4-(methylaminomethyl)piperidin-1-yl]-3-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one;hydrochloride |
| SMILES | CNCC1CCN(C(=O)CCNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1.Cl |
| InChI | InChI=1S/C17H23F3N4O3.ClH/c1-21-11-12-5-8-23(9-6-12)16(25)4-7-22-14-3-2-13(17(18,19)20)10-15(14)24(26)27;/h2-3,10,12,21-22H,4-9,11H2,1H3;1H |
| InChIKey | BBIIVIWCGSZLLI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.85 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|