C19H22F3N5O4 — CID 134063660
1-[4-[(3-methyl-1,2-oxazol-5-yl)methyl]piperazin-1-yl]-3-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one (PubChem CID 134063660) has the molecular formula C19H22F3N5O4 and a molecular weight of 441.41 g/mol. Its IUPAC name is 1-[4-[(3-methyl-1,2-oxazol-5-yl)methyl]piperazin-1-yl]-3-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one.
| Compound Name | 1-[4-[(3-methyl-1,2-oxazol-5-yl)methyl]piperazin-1-yl]-3-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one |
|---|---|
| PubChem CID | 134063660 |
| Molecular Formula | C19H22F3N5O4 |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 1-[4-[(3-methyl-1,2-oxazol-5-yl)methyl]piperazin-1-yl]-3-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one |
| SMILES | Cc1cc(CN2CCN(C(=O)CCNc3ccc(C(F)(F)F)cc3[N+](=O)[O-])CC2)on1 |
| InChI | InChI=1S/C19H22F3N5O4/c1-13-10-15(31-24-13)12-25-6-8-26(9-7-25)18(28)4-5-23-16-3-2-14(19(20,21)22)11-17(16)27(29)30/h2-3,10-11,23H,4-9,12H2,1H3 |
| InChIKey | YJAQDZRAZFGZAA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 104.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|