C22H27F3N6O3 — CID 55433307
1-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]-3-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one (PubChem CID 55433307) has the molecular formula C22H27F3N6O3 and a molecular weight of 480.49 g/mol. Its IUPAC name is 1-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]-3-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one.
| Compound Name | 1-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]-3-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one |
|---|---|
| PubChem CID | 55433307 |
| Molecular Formula | C22H27F3N6O3 |
| Molecular Weight | 480.49 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 1-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]-3-[2-nitro-4-(trifluoromethyl)anilino]propan-1-one |
| SMILES | Cc1cc(N2CCN(C(=O)CCNc3ccc(C(F)(F)F)cc3[N+](=O)[O-])CC2)nc(C(C)C)n1 |
| InChI | InChI=1S/C22H27F3N6O3/c1-14(2)21-27-15(3)12-19(28-21)29-8-10-30(11-9-29)20(32)6-7-26-17-5-4-16(22(23,24)25)13-18(17)31(33)34/h4-5,12-14,26H,6-11H2,1-3H3 |
| InChIKey | FRXGSRYYKVYBFG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|