C18H20F3N5O2 — CID 133336093
1-(2,6-dimethylpyrimidin-4-yl)-N-[2-nitro-4-(trifluoromethyl)phenyl]piperidin-4-amine (PubChem CID 133336093) has the molecular formula C18H20F3N5O2 and a molecular weight of 395.39 g/mol. Its IUPAC name is 1-(2,6-dimethylpyrimidin-4-yl)-N-[2-nitro-4-(trifluoromethyl)phenyl]piperidin-4-amine.
| Compound Name | 1-(2,6-dimethylpyrimidin-4-yl)-N-[2-nitro-4-(trifluoromethyl)phenyl]piperidin-4-amine |
|---|---|
| PubChem CID | 133336093 |
| Molecular Formula | C18H20F3N5O2 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 1-(2,6-dimethylpyrimidin-4-yl)-N-[2-nitro-4-(trifluoromethyl)phenyl]piperidin-4-amine |
| SMILES | Cc1cc(N2CCC(Nc3ccc(C(F)(F)F)cc3[N+](=O)[O-])CC2)nc(C)n1 |
| InChI | InChI=1S/C18H20F3N5O2/c1-11-9-17(23-12(2)22-11)25-7-5-14(6-8-25)24-15-4-3-13(18(19,20)21)10-16(15)26(27)28/h3-4,9-10,14,24H,5-8H2,1-2H3 |
| InChIKey | MRBMWYRVYZQMHB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|