C16H19ClN6O2 — CID 133336336
3-chloro-N-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-5-nitropyridin-2-amine (PubChem CID 133336336) has the molecular formula C16H19ClN6O2 and a molecular weight of 362.82 g/mol. Its IUPAC name is 3-chloro-N-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-5-nitropyridin-2-amine.
| Compound Name | 3-chloro-N-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 133336336 |
| Molecular Formula | C16H19ClN6O2 |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 3-chloro-N-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-5-nitropyridin-2-amine |
| SMILES | Cc1cc(N2CCC(Nc3ncc([N+](=O)[O-])cc3Cl)CC2)nc(C)n1 |
| InChI | InChI=1S/C16H19ClN6O2/c1-10-7-15(20-11(2)19-10)22-5-3-12(4-6-22)21-16-14(17)8-13(9-18-16)23(24)25/h7-9,12H,3-6H2,1-2H3,(H,18,21) |
| InChIKey | ROWNPTGDQDCOTC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|