C17H19ClN4O3 — CID 133304684
3-chloro-N-[1-(3-methoxyphenyl)piperidin-3-yl]-5-nitropyridin-2-amine (PubChem CID 133304684) has the molecular formula C17H19ClN4O3 and a molecular weight of 362.82 g/mol. Its IUPAC name is 3-chloro-N-[1-(3-methoxyphenyl)piperidin-3-yl]-5-nitropyridin-2-amine.
| Compound Name | 3-chloro-N-[1-(3-methoxyphenyl)piperidin-3-yl]-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 133304684 |
| Molecular Formula | C17H19ClN4O3 |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 3-chloro-N-[1-(3-methoxyphenyl)piperidin-3-yl]-5-nitropyridin-2-amine |
| SMILES | COc1cccc(N2CCCC(Nc3ncc([N+](=O)[O-])cc3Cl)C2)c1 |
| InChI | InChI=1S/C17H19ClN4O3/c1-25-15-6-2-5-13(8-15)21-7-3-4-12(11-21)20-17-16(18)9-14(10-19-17)22(23)24/h2,5-6,8-10,12H,3-4,7,11H2,1H3,(H,19,20) |
| InChIKey | PNUCMVRXQIVJJF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|