C10H11ClN4O4 — CID 133385700
methyl 3-[(3-chloro-5-nitro-2-pyridinyl)amino]azetidine-1-carboxylate (PubChem CID 133385700) has the molecular formula C10H11ClN4O4 and a molecular weight of 286.68 g/mol. Its IUPAC name is methyl 3-[(3-chloro-5-nitro-2-pyridinyl)amino]azetidine-1-carboxylate.
| Compound Name | methyl 3-[(3-chloro-5-nitro-2-pyridinyl)amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 133385700 |
| Molecular Formula | C10H11ClN4O4 |
| Molecular Weight | 286.68 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | methyl 3-[(3-chloro-5-nitro-2-pyridinyl)amino]azetidine-1-carboxylate |
| SMILES | COC(=O)N1CC(Nc2ncc([N+](=O)[O-])cc2Cl)C1 |
| InChI | InChI=1S/C10H11ClN4O4/c1-19-10(16)14-4-6(5-14)13-9-8(11)2-7(3-12-9)15(17)18/h2-3,6H,4-5H2,1H3,(H,12,13) |
| InChIKey | YUTVXPMUSHTOIZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.68 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|