C15H20ClN3O3 — CID 133378045
3-chloro-5-nitro-N-(1-oxaspiro[5.5]undecan-4-yl)pyridin-2-amine (PubChem CID 133378045) has the molecular formula C15H20ClN3O3 and a molecular weight of 325.80 g/mol. Its IUPAC name is 3-chloro-5-nitro-N-(1-oxaspiro[5.5]undecan-4-yl)pyridin-2-amine.
| Compound Name | 3-chloro-5-nitro-N-(1-oxaspiro[5.5]undecan-4-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 133378045 |
| Molecular Formula | C15H20ClN3O3 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 3-chloro-5-nitro-N-(1-oxaspiro[5.5]undecan-4-yl)pyridin-2-amine |
| SMILES | O=[N+]([O-])c1cnc(NC2CCOC3(CCCCC3)C2)c(Cl)c1 |
| InChI | InChI=1S/C15H20ClN3O3/c16-13-8-12(19(20)21)10-17-14(13)18-11-4-7-22-15(9-11)5-2-1-3-6-15/h8,10-11H,1-7,9H2,(H,17,18) |
| InChIKey | WTEWPXLMURLGJD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|