C12H16BrN3O3 — CID 115563804
3-bromo-N-(2,2-dimethyloxan-4-yl)-5-nitropyridin-2-amine (PubChem CID 115563804) has the molecular formula C12H16BrN3O3 and a molecular weight of 330.18 g/mol. Its IUPAC name is 3-bromo-N-(2,2-dimethyloxan-4-yl)-5-nitropyridin-2-amine.
| Compound Name | 3-bromo-N-(2,2-dimethyloxan-4-yl)-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 115563804 |
| Molecular Formula | C12H16BrN3O3 |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 3-bromo-N-(2,2-dimethyloxan-4-yl)-5-nitropyridin-2-amine |
| SMILES | CC1(C)CC(Nc2ncc([N+](=O)[O-])cc2Br)CCO1 |
| InChI | InChI=1S/C12H16BrN3O3/c1-12(2)6-8(3-4-19-12)15-11-10(13)5-9(7-14-11)16(17)18/h5,7-8H,3-4,6H2,1-2H3,(H,14,15) |
| InChIKey | QJUKRQNBXXXAFE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|