C12H17BrN2O — CID 104777207
3-bromo-N-(2,2-dimethyloxan-4-yl)pyridin-4-amine (PubChem CID 104777207) has the molecular formula C12H17BrN2O and a molecular weight of 285.18 g/mol. Its IUPAC name is 3-bromo-N-(2,2-dimethyloxan-4-yl)pyridin-4-amine.
| Compound Name | 3-bromo-N-(2,2-dimethyloxan-4-yl)pyridin-4-amine |
|---|---|
| PubChem CID | 104777207 |
| Molecular Formula | C12H17BrN2O |
| Molecular Weight | 285.18 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 3-bromo-N-(2,2-dimethyloxan-4-yl)pyridin-4-amine |
| SMILES | CC1(C)CC(Nc2ccncc2Br)CCO1 |
| InChI | InChI=1S/C12H17BrN2O/c1-12(2)7-9(4-6-16-12)15-11-3-5-14-8-10(11)13/h3,5,8-9H,4,6-7H2,1-2H3,(H,14,15) |
| InChIKey | XBSFQGXKPIBKDC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.18 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |