C14H19BrClNO — CID 104722830
N-(2-bromo-5-chloro-4-methylphenyl)-2,2-dimethyloxan-4-amine (PubChem CID 104722830) has the molecular formula C14H19BrClNO and a molecular weight of 332.67 g/mol. Its IUPAC name is N-(2-bromo-5-chloro-4-methylphenyl)-2,2-dimethyloxan-4-amine.
| Compound Name | N-(2-bromo-5-chloro-4-methylphenyl)-2,2-dimethyloxan-4-amine |
|---|---|
| PubChem CID | 104722830 |
| Molecular Formula | C14H19BrClNO |
| Molecular Weight | 332.67 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | N-(2-bromo-5-chloro-4-methylphenyl)-2,2-dimethyloxan-4-amine |
| SMILES | Cc1cc(Br)c(NC2CCOC(C)(C)C2)cc1Cl |
| InChI | InChI=1S/C14H19BrClNO/c1-9-6-11(15)13(7-12(9)16)17-10-4-5-18-14(2,3)8-10/h6-7,10,17H,4-5,8H2,1-3H3 |
| InChIKey | XEOFJELMBBTUGT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.67 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |