C17H24BrClN2 — CID 104722912
N-(2-bromo-5-chloro-4-methylphenyl)-1-(3-methylbut-2-enyl)piperidin-4-amine (PubChem CID 104722912) has the molecular formula C17H24BrClN2 and a molecular weight of 371.75 g/mol. Its IUPAC name is N-(2-bromo-5-chloro-4-methylphenyl)-1-(3-methylbut-2-enyl)piperidin-4-amine.
| Compound Name | N-(2-bromo-5-chloro-4-methylphenyl)-1-(3-methylbut-2-enyl)piperidin-4-amine |
|---|---|
| PubChem CID | 104722912 |
| Molecular Formula | C17H24BrClN2 |
| Molecular Weight | 371.75 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | N-(2-bromo-5-chloro-4-methylphenyl)-1-(3-methylbut-2-enyl)piperidin-4-amine |
| SMILES | CC(C)=CCN1CCC(Nc2cc(Cl)c(C)cc2Br)CC1 |
| InChI | InChI=1S/C17H24BrClN2/c1-12(2)4-7-21-8-5-14(6-9-21)20-17-11-16(19)13(3)10-15(17)18/h4,10-11,14,20H,5-9H2,1-3H3 |
| InChIKey | QCFGPIJZEHXSSI-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.75 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|