C15H18Cl2N2 — CID 104726156
N-(2,5-dichloro-4-methylphenyl)-1-prop-2-ynylpiperidin-4-amine (PubChem CID 104726156) has the molecular formula C15H18Cl2N2 and a molecular weight of 297.23 g/mol. Its IUPAC name is N-(2,5-dichloro-4-methylphenyl)-1-prop-2-ynylpiperidin-4-amine.
| Compound Name | N-(2,5-dichloro-4-methylphenyl)-1-prop-2-ynylpiperidin-4-amine |
|---|---|
| PubChem CID | 104726156 |
| Molecular Formula | C15H18Cl2N2 |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | N-(2,5-dichloro-4-methylphenyl)-1-prop-2-ynylpiperidin-4-amine |
| SMILES | C#CCN1CCC(Nc2cc(Cl)c(C)cc2Cl)CC1 |
| InChI | InChI=1S/C15H18Cl2N2/c1-3-6-19-7-4-12(5-8-19)18-15-10-13(16)11(2)9-14(15)17/h1,9-10,12,18H,4-8H2,2H3 |
| InChIKey | JJIKSVSIGBREQR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|