C14H20Cl2N2 — CID 104726429
N-(2,5-dichloro-4-methylphenyl)-1-propan-2-ylpyrrolidin-3-amine (PubChem CID 104726429) has the molecular formula C14H20Cl2N2 and a molecular weight of 287.23 g/mol. Its IUPAC name is N-(2,5-dichloro-4-methylphenyl)-1-propan-2-ylpyrrolidin-3-amine.
| Compound Name | N-(2,5-dichloro-4-methylphenyl)-1-propan-2-ylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 104726429 |
| Molecular Formula | C14H20Cl2N2 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | N-(2,5-dichloro-4-methylphenyl)-1-propan-2-ylpyrrolidin-3-amine |
| SMILES | Cc1cc(Cl)c(NC2CCN(C(C)C)C2)cc1Cl |
| InChI | InChI=1S/C14H20Cl2N2/c1-9(2)18-5-4-11(8-18)17-14-7-12(15)10(3)6-13(14)16/h6-7,9,11,17H,4-5,8H2,1-3H3 |
| InChIKey | KKGKWUILQZEQRY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |