C10H11Cl2N — CID 103439355
2,5-dichloro-N-cyclopropyl-4-methylaniline (PubChem CID 103439355) has the molecular formula C10H11Cl2N and a molecular weight of 216.11 g/mol. Its IUPAC name is 2,5-dichloro-N-cyclopropyl-4-methylaniline.
| Compound Name | 2,5-dichloro-N-cyclopropyl-4-methylaniline |
|---|---|
| PubChem CID | 103439355 |
| Molecular Formula | C10H11Cl2N |
| Molecular Weight | 216.11 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 2,5-dichloro-N-cyclopropyl-4-methylaniline |
| SMILES | Cc1cc(Cl)c(NC2CC2)cc1Cl |
| InChI | InChI=1S/C10H11Cl2N/c1-6-4-9(12)10(5-8(6)11)13-7-2-3-7/h4-5,7,13H,2-3H2,1H3 |
| InChIKey | IZMSPUBQEIQTBZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.11 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |