C12H14Cl3N — CID 28553160
2,4,5-trichloro-N-cyclohexylaniline (PubChem CID 28553160) has the molecular formula C12H14Cl3N and a molecular weight of 278.61 g/mol. Its IUPAC name is 2,4,5-trichloro-N-cyclohexylaniline.
| Compound Name | 2,4,5-trichloro-N-cyclohexylaniline |
|---|---|
| PubChem CID | 28553160 |
| Molecular Formula | C12H14Cl3N |
| Molecular Weight | 278.61 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 2,4,5-trichloro-N-cyclohexylaniline |
| SMILES | Clc1cc(Cl)c(NC2CCCCC2)cc1Cl |
| InChI | InChI=1S/C12H14Cl3N/c13-9-6-11(15)12(7-10(9)14)16-8-4-2-1-3-5-8/h6-8,16H,1-5H2 |
| InChIKey | MMKSJAJQDWHJKZ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.61 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|