C14H18Cl3N — CID 63419239
2,4,5-trichloro-N-(1-cyclohexylethyl)aniline (PubChem CID 63419239) has the molecular formula C14H18Cl3N and a molecular weight of 306.66 g/mol. Its IUPAC name is 2,4,5-trichloro-N-(1-cyclohexylethyl)aniline.
| Compound Name | 2,4,5-trichloro-N-(1-cyclohexylethyl)aniline |
|---|---|
| PubChem CID | 63419239 |
| Molecular Formula | C14H18Cl3N |
| Molecular Weight | 306.66 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 2,4,5-trichloro-N-(1-cyclohexylethyl)aniline |
| SMILES | CC(Nc1cc(Cl)c(Cl)cc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C14H18Cl3N/c1-9(10-5-3-2-4-6-10)18-14-8-12(16)11(15)7-13(14)17/h7-10,18H,2-6H2,1H3 |
| InChIKey | HEWCLJKPHBEILY-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.66 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|