C16H25N — CID 43755727
N-(1-cyclohexylethyl)-2,4-dimethylaniline (PubChem CID 43755727) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is N-(1-cyclohexylethyl)-2,4-dimethylaniline.
| Compound Name | N-(1-cyclohexylethyl)-2,4-dimethylaniline |
|---|---|
| PubChem CID | 43755727 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | N-(1-cyclohexylethyl)-2,4-dimethylaniline |
| SMILES | Cc1ccc(NC(C)C2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C16H25N/c1-12-9-10-16(13(2)11-12)17-14(3)15-7-5-4-6-8-15/h9-11,14-15,17H,4-8H2,1-3H3 |
| InChIKey | CTCCJIHBSLUKSN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |