C19H31N — CID 81390923
(1S)-1-cycloheptyl-N-[1-(2,5-dimethylphenyl)ethyl]ethanamine (PubChem CID 81390923) has the molecular formula C19H31N and a molecular weight of 273.46 g/mol. Its IUPAC name is (1S)-1-cycloheptyl-N-[1-(2,5-dimethylphenyl)ethyl]ethanamine.
| Compound Name | (1S)-1-cycloheptyl-N-[1-(2,5-dimethylphenyl)ethyl]ethanamine |
|---|---|
| PubChem CID | 81390923 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | (1S)-1-cycloheptyl-N-[1-(2,5-dimethylphenyl)ethyl]ethanamine |
| SMILES | Cc1ccc(C)c(C(C)N[C@@H](C)C2CCCCCC2)c1 |
| InChI | InChI=1S/C19H31N/c1-14-11-12-15(2)19(13-14)17(4)20-16(3)18-9-7-5-6-8-10-18/h11-13,16-18,20H,5-10H2,1-4H3/t16-,17?/m0/s1 |
| InChIKey | DMBBHIKEZKWBDS-BHWOMJMDSA-N |
| XLogP | 5.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |