C17H25Br2N — CID 81391306
(1S)-1-cycloheptyl-N-[1-(2,4-dibromophenyl)ethyl]ethanamine (PubChem CID 81391306) has the molecular formula C17H25Br2N and a molecular weight of 403.20 g/mol. Its IUPAC name is (1S)-1-cycloheptyl-N-[1-(2,4-dibromophenyl)ethyl]ethanamine.
| Compound Name | (1S)-1-cycloheptyl-N-[1-(2,4-dibromophenyl)ethyl]ethanamine |
|---|---|
| PubChem CID | 81391306 |
| Molecular Formula | C17H25Br2N |
| Molecular Weight | 403.20 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | (1S)-1-cycloheptyl-N-[1-(2,4-dibromophenyl)ethyl]ethanamine |
| SMILES | CC(N[C@@H](C)C1CCCCCC1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C17H25Br2N/c1-12(14-7-5-3-4-6-8-14)20-13(2)16-10-9-15(18)11-17(16)19/h9-14,20H,3-8H2,1-2H3/t12-,13?/m0/s1 |
| InChIKey | VJVHOIZJKWVROE-UEWDXFNNSA-N |
| XLogP | 6.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.20 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |