C18H19Br2N — CID 60781974
N-[cyclopropyl(phenyl)methyl]-1-(2,4-dibromophenyl)ethanamine (PubChem CID 60781974) has the molecular formula C18H19Br2N and a molecular weight of 409.17 g/mol. Its IUPAC name is N-[cyclopropyl(phenyl)methyl]-1-(2,4-dibromophenyl)ethanamine.
| Compound Name | N-[cyclopropyl(phenyl)methyl]-1-(2,4-dibromophenyl)ethanamine |
|---|---|
| PubChem CID | 60781974 |
| Molecular Formula | C18H19Br2N |
| Molecular Weight | 409.17 g/mol |
| Exact Mass | 406.99 |
| IUPAC Name | N-[cyclopropyl(phenyl)methyl]-1-(2,4-dibromophenyl)ethanamine |
| SMILES | CC(NC(c1ccccc1)C1CC1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C18H19Br2N/c1-12(16-10-9-15(19)11-17(16)20)21-18(14-7-8-14)13-5-3-2-4-6-13/h2-6,9-12,14,18,21H,7-8H2,1H3 |
| InChIKey | YWVKASATGFYDLL-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.17 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |