C14H19Br2N — CID 60781569
N-(cyclopentylmethyl)-1-(2,4-dibromophenyl)ethanamine (PubChem CID 60781569) has the molecular formula C14H19Br2N and a molecular weight of 361.12 g/mol. Its IUPAC name is N-(cyclopentylmethyl)-1-(2,4-dibromophenyl)ethanamine.
| Compound Name | N-(cyclopentylmethyl)-1-(2,4-dibromophenyl)ethanamine |
|---|---|
| PubChem CID | 60781569 |
| Molecular Formula | C14H19Br2N |
| Molecular Weight | 361.12 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | N-(cyclopentylmethyl)-1-(2,4-dibromophenyl)ethanamine |
| SMILES | CC(NCC1CCCC1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C14H19Br2N/c1-10(17-9-11-4-2-3-5-11)13-7-6-12(15)8-14(13)16/h6-8,10-11,17H,2-5,9H2,1H3 |
| InChIKey | FJZFLTMHLBXKIT-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.12 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |