C13H17Br2N — CID 60781645
N-(cyclobutylmethyl)-1-(2,4-dibromophenyl)ethanamine (PubChem CID 60781645) has the molecular formula C13H17Br2N and a molecular weight of 347.09 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-1-(2,4-dibromophenyl)ethanamine.
| Compound Name | N-(cyclobutylmethyl)-1-(2,4-dibromophenyl)ethanamine |
|---|---|
| PubChem CID | 60781645 |
| Molecular Formula | C13H17Br2N |
| Molecular Weight | 347.09 g/mol |
| Exact Mass | 344.97 |
| IUPAC Name | N-(cyclobutylmethyl)-1-(2,4-dibromophenyl)ethanamine |
| SMILES | CC(NCC1CCC1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H17Br2N/c1-9(16-8-10-3-2-4-10)12-6-5-11(14)7-13(12)15/h5-7,9-10,16H,2-4,8H2,1H3 |
| InChIKey | HXUGTJAUOMDYNP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.09 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |