C16H23Br2N — CID 63448416
N-(2-cyclohexylethyl)-1-(2,4-dibromophenyl)ethanamine (PubChem CID 63448416) has the molecular formula C16H23Br2N and a molecular weight of 389.18 g/mol. Its IUPAC name is N-(2-cyclohexylethyl)-1-(2,4-dibromophenyl)ethanamine.
| Compound Name | N-(2-cyclohexylethyl)-1-(2,4-dibromophenyl)ethanamine |
|---|---|
| PubChem CID | 63448416 |
| Molecular Formula | C16H23Br2N |
| Molecular Weight | 389.18 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | N-(2-cyclohexylethyl)-1-(2,4-dibromophenyl)ethanamine |
| SMILES | CC(NCCC1CCCCC1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C16H23Br2N/c1-12(15-8-7-14(17)11-16(15)18)19-10-9-13-5-3-2-4-6-13/h7-8,11-13,19H,2-6,9-10H2,1H3 |
| InChIKey | IGIJOHATLTUPBV-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.18 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |