C15H22Br2N2 — CID 114193446
[3-cyclohexyl-1-(2,4-dibromophenyl)propyl]hydrazine (PubChem CID 114193446) has the molecular formula C15H22Br2N2 and a molecular weight of 390.16 g/mol. Its IUPAC name is [3-cyclohexyl-1-(2,4-dibromophenyl)propyl]hydrazine.
| Compound Name | [3-cyclohexyl-1-(2,4-dibromophenyl)propyl]hydrazine |
|---|---|
| PubChem CID | 114193446 |
| Molecular Formula | C15H22Br2N2 |
| Molecular Weight | 390.16 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | [3-cyclohexyl-1-(2,4-dibromophenyl)propyl]hydrazine |
| SMILES | NNC(CCC1CCCCC1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C15H22Br2N2/c16-12-7-8-13(14(17)10-12)15(19-18)9-6-11-4-2-1-3-5-11/h7-8,10-11,15,19H,1-6,9,18H2 |
| InChIKey | ZSBWRNJTWHNCGZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.16 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|