C14H17Br3 — CID 55200090
1,4-dibromo-2-(1-bromo-3-cyclopentylpropyl)benzene (PubChem CID 55200090) has the molecular formula C14H17Br3 and a molecular weight of 425.00 g/mol. Its IUPAC name is 1,4-dibromo-2-(1-bromo-3-cyclopentylpropyl)benzene.
| Compound Name | 1,4-dibromo-2-(1-bromo-3-cyclopentylpropyl)benzene |
|---|---|
| PubChem CID | 55200090 |
| Molecular Formula | C14H17Br3 |
| Molecular Weight | 425.00 g/mol |
| Exact Mass | 421.89 |
| IUPAC Name | 1,4-dibromo-2-(1-bromo-3-cyclopentylpropyl)benzene |
| SMILES | Brc1ccc(Br)c(C(Br)CCC2CCCC2)c1 |
| InChI | InChI=1S/C14H17Br3/c15-11-6-8-14(17)12(9-11)13(16)7-5-10-3-1-2-4-10/h6,8-10,13H,1-5,7H2 |
| InChIKey | UXBWFCNEHYYUGW-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.00 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|