C17H25Br — CID 63438485
1-(1-bromo-3-cyclohexylpropyl)-2,4-dimethylbenzene (PubChem CID 63438485) has the molecular formula C17H25Br and a molecular weight of 309.29 g/mol. Its IUPAC name is 1-(1-bromo-3-cyclohexylpropyl)-2,4-dimethylbenzene.
| Compound Name | 1-(1-bromo-3-cyclohexylpropyl)-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 63438485 |
| Molecular Formula | C17H25Br |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 1-(1-bromo-3-cyclohexylpropyl)-2,4-dimethylbenzene |
| SMILES | Cc1ccc(C(Br)CCC2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C17H25Br/c1-13-8-10-16(14(2)12-13)17(18)11-9-15-6-4-3-5-7-15/h8,10,12,15,17H,3-7,9,11H2,1-2H3 |
| InChIKey | UQCDHORKWDJTIW-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|