C16H24Br2N2 — CID 63454032
N-[2-(azepan-1-yl)ethyl]-1-(2,4-dibromophenyl)ethanamine (PubChem CID 63454032) has the molecular formula C16H24Br2N2 and a molecular weight of 404.19 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)ethyl]-1-(2,4-dibromophenyl)ethanamine.
| Compound Name | N-[2-(azepan-1-yl)ethyl]-1-(2,4-dibromophenyl)ethanamine |
|---|---|
| PubChem CID | 63454032 |
| Molecular Formula | C16H24Br2N2 |
| Molecular Weight | 404.19 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | N-[2-(azepan-1-yl)ethyl]-1-(2,4-dibromophenyl)ethanamine |
| SMILES | CC(NCCN1CCCCCC1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C16H24Br2N2/c1-13(15-7-6-14(17)12-16(15)18)19-8-11-20-9-4-2-3-5-10-20/h6-7,12-13,19H,2-5,8-11H2,1H3 |
| InChIKey | HWDMSRVCRLYRNX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.19 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |