C16H21Br2N — CID 60781439
N-[2-(cyclohexen-1-yl)ethyl]-1-(2,4-dibromophenyl)ethanamine (PubChem CID 60781439) has the molecular formula C16H21Br2N and a molecular weight of 387.16 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-1-(2,4-dibromophenyl)ethanamine.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-1-(2,4-dibromophenyl)ethanamine |
|---|---|
| PubChem CID | 60781439 |
| Molecular Formula | C16H21Br2N |
| Molecular Weight | 387.16 g/mol |
| Exact Mass | 385.00 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-1-(2,4-dibromophenyl)ethanamine |
| SMILES | CC(NCCC1=CCCCC1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C16H21Br2N/c1-12(15-8-7-14(17)11-16(15)18)19-10-9-13-5-3-2-4-6-13/h5,7-8,11-12,19H,2-4,6,9-10H2,1H3 |
| InChIKey | UOFPAMLUBGYTSL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.16 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|