C17H22BrNO — CID 43371437
1-(5-bromo-1-benzofuran-2-yl)-N-(cyclohexylmethyl)ethanamine (PubChem CID 43371437) has the molecular formula C17H22BrNO and a molecular weight of 336.27 g/mol. Its IUPAC name is 1-(5-bromo-1-benzofuran-2-yl)-N-(cyclohexylmethyl)ethanamine.
| Compound Name | 1-(5-bromo-1-benzofuran-2-yl)-N-(cyclohexylmethyl)ethanamine |
|---|---|
| PubChem CID | 43371437 |
| Molecular Formula | C17H22BrNO |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 1-(5-bromo-1-benzofuran-2-yl)-N-(cyclohexylmethyl)ethanamine |
| SMILES | CC(NCC1CCCCC1)c1cc2cc(Br)ccc2o1 |
| InChI | InChI=1S/C17H22BrNO/c1-12(19-11-13-5-3-2-4-6-13)17-10-14-9-15(18)7-8-16(14)20-17/h7-10,12-13,19H,2-6,11H2,1H3 |
| InChIKey | VNZMZXQDBYPOBJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |