C14H19Br2N — CID 43789277
2,5-dibromo-N-(1-cyclohexylethyl)aniline (PubChem CID 43789277) has the molecular formula C14H19Br2N and a molecular weight of 361.12 g/mol. Its IUPAC name is 2,5-dibromo-N-(1-cyclohexylethyl)aniline.
| Compound Name | 2,5-dibromo-N-(1-cyclohexylethyl)aniline |
|---|---|
| PubChem CID | 43789277 |
| Molecular Formula | C14H19Br2N |
| Molecular Weight | 361.12 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | 2,5-dibromo-N-(1-cyclohexylethyl)aniline |
| SMILES | CC(Nc1cc(Br)ccc1Br)C1CCCCC1 |
| InChI | InChI=1S/C14H19Br2N/c1-10(11-5-3-2-4-6-11)17-14-9-12(15)7-8-13(14)16/h7-11,17H,2-6H2,1H3 |
| InChIKey | JDISHPMNJRCPFX-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.12 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |