C13H16Br3N — CID 55200172
2,4,6-tribromo-N-(1-cyclopentylethyl)aniline (PubChem CID 55200172) has the molecular formula C13H16Br3N and a molecular weight of 425.99 g/mol. Its IUPAC name is 2,4,6-tribromo-N-(1-cyclopentylethyl)aniline.
| Compound Name | 2,4,6-tribromo-N-(1-cyclopentylethyl)aniline |
|---|---|
| PubChem CID | 55200172 |
| Molecular Formula | C13H16Br3N |
| Molecular Weight | 425.99 g/mol |
| Exact Mass | 422.88 |
| IUPAC Name | 2,4,6-tribromo-N-(1-cyclopentylethyl)aniline |
| SMILES | CC(Nc1c(Br)cc(Br)cc1Br)C1CCCC1 |
| InChI | InChI=1S/C13H16Br3N/c1-8(9-4-2-3-5-9)17-13-11(15)6-10(14)7-12(13)16/h6-9,17H,2-5H2,1H3 |
| InChIKey | JRWLNHJSBCVWQP-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.99 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |