C15H21Br2N — CID 55199408
2,6-dibromo-N-(1-cyclohexylethyl)-4-methylaniline (PubChem CID 55199408) has the molecular formula C15H21Br2N and a molecular weight of 375.15 g/mol. Its IUPAC name is 2,6-dibromo-N-(1-cyclohexylethyl)-4-methylaniline.
| Compound Name | 2,6-dibromo-N-(1-cyclohexylethyl)-4-methylaniline |
|---|---|
| PubChem CID | 55199408 |
| Molecular Formula | C15H21Br2N |
| Molecular Weight | 375.15 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 2,6-dibromo-N-(1-cyclohexylethyl)-4-methylaniline |
| SMILES | Cc1cc(Br)c(NC(C)C2CCCCC2)c(Br)c1 |
| InChI | InChI=1S/C15H21Br2N/c1-10-8-13(16)15(14(17)9-10)18-11(2)12-6-4-3-5-7-12/h8-9,11-12,18H,3-7H2,1-2H3 |
| InChIKey | GETKMFIBPGLQJU-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.15 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |